C14H19F3N8S — CID 21298695
1-cyano-2-methyl-3-[2-[[6-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-2-pyridinyl]methylsulfanyl]ethyl]guanidine (PubChem CID 21298695) has the molecular formula C14H19F3N8S and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[2-[[6-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-2-pyridinyl]methylsulfanyl]ethyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[2-[[6-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-2-pyridinyl]methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 21298695 |
| Molecular Formula | C14H19F3N8S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-cyano-2-methyl-3-[2-[[6-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-2-pyridinyl]methylsulfanyl]ethyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCSCc1cccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C14H19F3N8S/c1-20-13(23-9-18)21-5-6-26-7-10-3-2-4-11(24-10)25-12(19)22-8-14(15,16)17/h2-4H,5-8H2,1H3,(H2,20,21,23)(H3,19,22,24,25) |
| InChIKey | CYONCEDZRSXBFJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|