C11H17F3N6S — CID 21298746
1-[2-(4-aminobutylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21298746) has the molecular formula C11H17F3N6S and a molecular weight of 322.36 g/mol. Its IUPAC name is 1-[2-(4-aminobutylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[2-(4-aminobutylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21298746 |
| Molecular Formula | C11H17F3N6S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-[2-(4-aminobutylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | NCCCCSc1nccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C11H17F3N6S/c12-11(13,14)7-18-9(16)19-8-3-5-17-10(20-8)21-6-2-1-4-15/h3,5H,1-2,4,6-7,15H2,(H3,16,17,18,19,20) |
| InChIKey | SBLXFIBRVBFITQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|