C9H13F3N6S — CID 21298751
1-[6-(2-aminoethylsulfanyl)pyrazin-2-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21298751) has the molecular formula C9H13F3N6S and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-[6-(2-aminoethylsulfanyl)pyrazin-2-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[6-(2-aminoethylsulfanyl)pyrazin-2-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21298751 |
| Molecular Formula | C9H13F3N6S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-[6-(2-aminoethylsulfanyl)pyrazin-2-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | NCCSc1cncc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C9H13F3N6S/c10-9(11,12)5-16-8(14)18-6-3-15-4-7(17-6)19-2-1-13/h3-4H,1-2,5,13H2,(H3,14,16,17,18) |
| InChIKey | VMMBBFNVXODZMF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|