C12H21F3N8O2S — CID 21298761
2-methyl-1-methylsulfonyl-3-[3-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]propyl]guanidine (PubChem CID 21298761) has the molecular formula C12H21F3N8O2S and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-methyl-1-methylsulfonyl-3-[3-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]propyl]guanidine.
| Compound Name | 2-methyl-1-methylsulfonyl-3-[3-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]propyl]guanidine |
|---|---|
| PubChem CID | 21298761 |
| Molecular Formula | C12H21F3N8O2S |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-methyl-1-methylsulfonyl-3-[3-[3-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]propyl]guanidine |
| SMILES | C/N=C(/NCCCn1ccc(N/C(N)=N/CC(F)(F)F)n1)NS(C)(=O)=O |
| InChI | InChI=1S/C12H21F3N8O2S/c1-17-11(22-26(2,24)25)18-5-3-6-23-7-4-9(21-23)20-10(16)19-8-12(13,14)15/h4,7H,3,5-6,8H2,1-2H3,(H2,17,18,22)(H3,16,19,20,21) |
| InChIKey | TVXWOBQMRAOTTC-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|