C6H8F3N5OS — CID 21298772
1-[3-(hydroxymethyl)-1,2,4-thiadiazol-5-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21298772) has the molecular formula C6H8F3N5OS and a molecular weight of 255.22 g/mol. Its IUPAC name is 1-[3-(hydroxymethyl)-1,2,4-thiadiazol-5-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[3-(hydroxymethyl)-1,2,4-thiadiazol-5-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21298772 |
| Molecular Formula | C6H8F3N5OS |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 1-[3-(hydroxymethyl)-1,2,4-thiadiazol-5-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N/C(=N\CC(F)(F)F)Nc1nc(CO)ns1 |
| InChI | InChI=1S/C6H8F3N5OS/c7-6(8,9)2-11-4(10)13-5-12-3(1-15)14-16-5/h15H,1-2H2,(H3,10,11,12,13,14) |
| InChIKey | HYMFZSBUWKKBRW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|