C13H20BrF3N8O2S2 — CID 21298775
1-[3-[5-bromo-4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylpropyl]-2-methyl-3-methylsulfonylguanidine (PubChem CID 21298775) has the molecular formula C13H20BrF3N8O2S2 and a molecular weight of 521.39 g/mol. Its IUPAC name is 1-[3-[5-bromo-4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylpropyl]-2-methyl-3-methylsulfonylguanidine.
| Compound Name | 1-[3-[5-bromo-4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylpropyl]-2-methyl-3-methylsulfonylguanidine |
|---|---|
| PubChem CID | 21298775 |
| Molecular Formula | C13H20BrF3N8O2S2 |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | 1-[3-[5-bromo-4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylpropyl]-2-methyl-3-methylsulfonylguanidine |
| SMILES | C/N=C(/NCCCSc1ncc(Br)c(N/C(N)=N/CC(F)(F)F)n1)NS(C)(=O)=O |
| InChI | InChI=1S/C13H20BrF3N8O2S2/c1-19-11(25-29(2,26)27)20-4-3-5-28-12-21-6-8(14)9(24-12)23-10(18)22-7-13(15,16)17/h6H,3-5,7H2,1-2H3,(H2,19,20,25)(H3,18,21,22,23,24) |
| InChIKey | MKNIXDHTOGJMCP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 146.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|