C11H16F3N9S2 — CID 21298796
1-cyano-2-methyl-3-[2-[[5-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,2,4-thiadiazol-3-yl]methylsulfanyl]ethyl]guanidine (PubChem CID 21298796) has the molecular formula C11H16F3N9S2 and a molecular weight of 395.44 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[2-[[5-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,2,4-thiadiazol-3-yl]methylsulfanyl]ethyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[2-[[5-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,2,4-thiadiazol-3-yl]methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 21298796 |
| Molecular Formula | C11H16F3N9S2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 1-cyano-2-methyl-3-[2-[[5-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,2,4-thiadiazol-3-yl]methylsulfanyl]ethyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCSCc1nsc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C11H16F3N9S2/c1-17-9(20-6-15)18-2-3-24-4-7-21-10(25-23-7)22-8(16)19-5-11(12,13)14/h2-5H2,1H3,(H2,17,18,20)(H3,16,19,21,22,23) |
| InChIKey | KXHWJHDRMZWFKE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|