C11H16F3N5S — CID 21298830
1-[6-(2-aminoethylsulfanylmethyl)-2-pyridinyl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21298830) has the molecular formula C11H16F3N5S and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-[6-(2-aminoethylsulfanylmethyl)-2-pyridinyl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[6-(2-aminoethylsulfanylmethyl)-2-pyridinyl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21298830 |
| Molecular Formula | C11H16F3N5S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-[6-(2-aminoethylsulfanylmethyl)-2-pyridinyl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | NCCSCc1cccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C11H16F3N5S/c12-11(13,14)7-17-10(16)19-9-3-1-2-8(18-9)6-20-5-4-15/h1-3H,4-7,15H2,(H3,16,17,18,19) |
| InChIKey | ORCCLKCYCUHNRT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|