C14H23F3N8O2S — CID 21298834
2-methyl-1-methylsulfonyl-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]guanidine (PubChem CID 21298834) has the molecular formula C14H23F3N8O2S and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-methyl-1-methylsulfonyl-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]guanidine.
| Compound Name | 2-methyl-1-methylsulfonyl-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]guanidine |
|---|---|
| PubChem CID | 21298834 |
| Molecular Formula | C14H23F3N8O2S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-methyl-1-methylsulfonyl-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]guanidine |
| SMILES | C/N=C(/NCCCCc1nccc(N/C(N)=N/CC(F)(F)F)n1)NS(C)(=O)=O |
| InChI | InChI=1S/C14H23F3N8O2S/c1-19-13(25-28(2,26)27)21-7-4-3-5-10-20-8-6-11(23-10)24-12(18)22-9-14(15,16)17/h6,8H,3-5,7,9H2,1-2H3,(H2,19,21,25)(H3,18,20,22,23,24) |
| InChIKey | BFHZIFZEOGTHQK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 146.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|