About 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea
1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea (PubChem CID 21298843) has the molecular formula C4H7F3N2O2S2
and a molecular weight of 236.24 g/mol. Its IUPAC name is 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea.
Molecular Properties
| Compound Name | 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea |
| PubChem CID | 21298843 |
| Molecular Formula | C4H7F3N2O2S2 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea |
| SMILES | CS(=O)(=O)NC(=S)NCC(F)(F)F |
| InChI | InChI=1S/C4H7F3N2O2S2/c1-13(10,11)9-3(12)8-2-4(5,6)7/h2H2,1H3,(H2,8,9,12) |
| InChIKey | GWLOXXPGVUKJGZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea?
The IUPAC name of 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea (CID 21298843) is 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea.
What is the SMILES notation for 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea?
The canonical SMILES for 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea is CS(=O)(=O)NC(=S)NCC(F)(F)F.
What is the InChIKey of 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea?
The InChIKey is GWLOXXPGVUKJGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7F3N2O2S2/c1-13(10,11)9-3(12)8-2-4(5,6)7/h2H2,1H3,(H2,8,9,12).
What are the key properties of 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea?
1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea has a molecular weight of 236.24 g/mol, XLogP of -0.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfonyl-3-(2,2,2-trifluoroethyl)thiourea is sourced from PubChem (CID 21298843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).