C9H14ClF2N5S2 — CID 21298852
1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2-chloro-2,2-difluoroethyl)guanidine (PubChem CID 21298852) has the molecular formula C9H14ClF2N5S2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2-chloro-2,2-difluoroethyl)guanidine.
| Compound Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2-chloro-2,2-difluoroethyl)guanidine |
|---|---|
| PubChem CID | 21298852 |
| Molecular Formula | C9H14ClF2N5S2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2-chloro-2,2-difluoroethyl)guanidine |
| SMILES | NCCSCc1csc(N/C(N)=N/CC(F)(F)Cl)n1 |
| InChI | InChI=1S/C9H14ClF2N5S2/c10-9(11,12)5-15-7(14)17-8-16-6(4-19-8)3-18-2-1-13/h4H,1-3,5,13H2,(H3,14,15,16,17) |
| InChIKey | BSCDWUNYTWSTAF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|