C11H20Cl2F3N5S — CID 21298863
1-[4-(4-aminobutyl)-5-methyl-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine;dihydrochloride (PubChem CID 21298863) has the molecular formula C11H20Cl2F3N5S and a molecular weight of 382.28 g/mol. Its IUPAC name is 1-[4-(4-aminobutyl)-5-methyl-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine;dihydrochloride.
| Compound Name | 1-[4-(4-aminobutyl)-5-methyl-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine;dihydrochloride |
|---|---|
| PubChem CID | 21298863 |
| Molecular Formula | C11H20Cl2F3N5S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1-[4-(4-aminobutyl)-5-methyl-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine;dihydrochloride |
| SMILES | Cc1sc(N/C(N)=N/CC(F)(F)F)nc1CCCCN.Cl.Cl |
| InChI | InChI=1S/C11H18F3N5S.2ClH/c1-7-8(4-2-3-5-15)18-10(20-7)19-9(16)17-6-11(12,13)14;;/h2-6,15H2,1H3,(H3,16,17,18,19);2*1H |
| InChIKey | LXLYYWDSIZQHMX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|