C9H11F3N6 — CID 21298879
1-[1-(2-cyanoethyl)pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21298879) has the molecular formula C9H11F3N6 and a molecular weight of 260.22 g/mol. Its IUPAC name is 1-[1-(2-cyanoethyl)pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[1-(2-cyanoethyl)pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21298879 |
| Molecular Formula | C9H11F3N6 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-[1-(2-cyanoethyl)pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N#CCCn1ccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N6/c10-9(11,12)6-15-8(14)16-7-2-5-18(17-7)4-1-3-13/h2,5H,1,4,6H2,(H3,14,15,16,17) |
| InChIKey | HKUMEEMCVVPKGN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|