C58H67N5O2 — CID 21299075
3,3-bis[2,2-bis(4-piperidin-1-ylphenyl)ethenyl]-6-(dimethylamino)-2-benzofuran-1-one (PubChem CID 21299075) has the molecular formula C58H67N5O2 and a molecular weight of 866.21 g/mol. Its IUPAC name is 3,3-bis[2,2-bis(4-piperidin-1-ylphenyl)ethenyl]-6-(dimethylamino)-2-benzofuran-1-one.
| Compound Name | 3,3-bis[2,2-bis(4-piperidin-1-ylphenyl)ethenyl]-6-(dimethylamino)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 21299075 |
| Molecular Formula | C58H67N5O2 |
| Molecular Weight | 866.21 g/mol |
| Exact Mass | 865.53 |
| IUPAC Name | 3,3-bis[2,2-bis(4-piperidin-1-ylphenyl)ethenyl]-6-(dimethylamino)-2-benzofuran-1-one |
| SMILES | CN(C)c1ccc2c(c1)C(=O)OC2(C=C(c1ccc(N2CCCCC2)cc1)c1ccc(N2CCCCC2)cc1)C=C(c1ccc(N2CCCCC2)cc1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C58H67N5O2/c1-59(2)52-31-32-56-53(41-52)57(64)65-58(56,42-54(44-15-23-48(24-16-44)60-33-7-3-8-34-60)45-17-25-49(26-18-45)61-35-9-4-10-36-61)43-55(46-19-27-50(28-20-46)62-37-11-5-12-38-62)47-21-29-51(30-22-47)63-39-13-6-14-40-63/h15-32,41-43H,3-14,33-40H2,1-2H3 |
| InChIKey | FRKNRSBWJPXUOX-UHFFFAOYSA-N |
| XLogP | 12.34 |
| TPSA | 42.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.21 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|