About 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride
3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride (PubChem CID 21299106) has the molecular formula C8H15ClN2O3S
and a molecular weight of 254.74 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride |
| PubChem CID | 21299106 |
| Molecular Formula | C8H15ClN2O3S |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride |
| SMILES | CC1NC(C(=O)NCCC(=O)O)CS1.Cl |
| InChI | InChI=1S/C8H14N2O3S.ClH/c1-5-10-6(4-14-5)8(13)9-3-2-7(11)12;/h5-6,10H,2-4H2,1H3,(H,9,13)(H,11,12);1H |
| InChIKey | BTOKFINPCIUCQM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride?
The IUPAC name of 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride (CID 21299106) is 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride.
What is the SMILES notation for 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride?
The canonical SMILES for 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride is CC1NC(C(=O)NCCC(=O)O)CS1.Cl.
What is the InChIKey of 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride?
The InChIKey is BTOKFINPCIUCQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3S.ClH/c1-5-10-6(4-14-5)8(13)9-3-2-7(11)12;/h5-6,10H,2-4H2,1H3,(H,9,13)(H,11,12);1H.
What are the key properties of 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride?
3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride has a molecular weight of 254.74 g/mol, XLogP of 0.05, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methyl-1,3-thiazolidine-4-carbonyl)amino]propanoic acid;hydrochloride is sourced from PubChem (CID 21299106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).