About amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole
amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole (PubChem CID 21299408) has the molecular formula C5H7N10O4+
and a molecular weight of 271.18 g/mol. Its IUPAC name is amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole.
Molecular Properties
| Compound Name | amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole |
| PubChem CID | 21299408 |
| Molecular Formula | C5H7N10O4+ |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole |
| SMILES | O=[N+]([O-])C1=C2N=NC([N+](=O)[O-])=C2N=N1.[H]/N=C(\N)[NH2+]N |
| InChI | InChI=1S/C4N6O4.CH6N4/c11-9(12)3-1-2(6-7-3)4(8-5-1)10(13)14;2-1(3)5-4/h;4H2,(H4,2,3,5)/p+1 |
| InChIKey | JSUAQTGPUGEXQW-UHFFFAOYSA-O |
| XLogP | -1.87 |
| TPSA | 228.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole?
The IUPAC name of amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole (CID 21299408) is amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole.
What is the SMILES notation for amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole?
The canonical SMILES for amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole is O=[N+]([O-])C1=C2N=NC([N+](=O)[O-])=C2N=N1.[H]/N=C(\N)[NH2+]N.
What is the InChIKey of amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole?
The InChIKey is JSUAQTGPUGEXQW-UHFFFAOYSA-O. The full InChI is InChI=1S/C4N6O4.CH6N4/c11-9(12)3-1-2(6-7-3)4(8-5-1)10(13)14;2-1(3)5-4/h;4H2,(H4,2,3,5)/p+1.
What are the key properties of amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole?
amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole has a molecular weight of 271.18 g/mol, XLogP of -1.87, 2 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for amino(carbamimidoyl)azanium;3,6-dinitropyrazolo[4,3-c]pyrazole is sourced from PubChem (CID 21299408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).