About 2-ethylhexan-1-ol;hydrate
2-ethylhexan-1-ol;hydrate (PubChem CID 21299410) has the molecular formula C8H20O2
and a molecular weight of 148.25 g/mol. Its IUPAC name is 2-ethylhexan-1-ol;hydrate.
Molecular Properties
| Compound Name | 2-ethylhexan-1-ol;hydrate |
| PubChem CID | 21299410 |
| Molecular Formula | C8H20O2 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.15 |
| IUPAC Name | 2-ethylhexan-1-ol;hydrate |
| SMILES | CCCCC(CC)CO.O |
| InChI | InChI=1S/C8H18O.H2O/c1-3-5-6-8(4-2)7-9;/h8-9H,3-7H2,1-2H3;1H2 |
| InChIKey | QFCCFXKCPXSXEN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylhexan-1-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexan-1-ol;hydrate?
The IUPAC name of 2-ethylhexan-1-ol;hydrate (CID 21299410) is 2-ethylhexan-1-ol;hydrate.
What is the SMILES notation for 2-ethylhexan-1-ol;hydrate?
The canonical SMILES for 2-ethylhexan-1-ol;hydrate is CCCCC(CC)CO.O.
What is the InChIKey of 2-ethylhexan-1-ol;hydrate?
The InChIKey is QFCCFXKCPXSXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.H2O/c1-3-5-6-8(4-2)7-9;/h8-9H,3-7H2,1-2H3;1H2.
What are the key properties of 2-ethylhexan-1-ol;hydrate?
2-ethylhexan-1-ol;hydrate has a molecular weight of 148.25 g/mol, XLogP of 1.37, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexan-1-ol;hydrate is sourced from PubChem (CID 21299410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).