C20H34NO4+ — CID 21299591
tert-butyl-[4-[(6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-2-hydroxybutan-2-yl]-dimethylazanium (PubChem CID 21299591) has the molecular formula C20H34NO4+ and a molecular weight of 352.50 g/mol. Its IUPAC name is tert-butyl-[4-[(6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-2-hydroxybutan-2-yl]-dimethylazanium.
| Compound Name | tert-butyl-[4-[(6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-2-hydroxybutan-2-yl]-dimethylazanium |
|---|---|
| PubChem CID | 21299591 |
| Molecular Formula | C20H34NO4+ |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | tert-butyl-[4-[(6,7-dihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-2-hydroxybutan-2-yl]-dimethylazanium |
| SMILES | CC(C)(C)[N+](C)(C)C(C)(O)CCOc1cccc2c1CC(O)C(O)C2 |
| InChI | InChI=1S/C20H34NO4/c1-19(2,3)21(5,6)20(4,24)10-11-25-18-9-7-8-14-12-16(22)17(23)13-15(14)18/h7-9,16-17,22-24H,10-13H2,1-6H3/q+1 |
| InChIKey | JYECMOWLWDLVKD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|