About 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide
3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide (PubChem CID 21299690) has the molecular formula C16H23N3O5
and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide.
Molecular Properties
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide |
| PubChem CID | 21299690 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide |
| SMILES | CC(=O)CNC(C=O)CCCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H23N3O5/c1-12(21)10-18-13(11-20)4-2-3-8-17-14(22)7-9-19-15(23)5-6-16(19)24/h5-6,11,13,18H,2-4,7-10H2,1H3,(H,17,22) |
| InChIKey | PEEIIPGYDGGGAK-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide (CID 21299690) is 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide is CC(=O)CNC(C=O)CCCCNC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide?
The InChIKey is PEEIIPGYDGGGAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O5/c1-12(21)10-18-13(11-20)4-2-3-8-17-14(22)7-9-19-15(23)5-6-16(19)24/h5-6,11,13,18H,2-4,7-10H2,1H3,(H,17,22).
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide?
3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide has a molecular weight of 337.38 g/mol, XLogP of -0.67, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)-N-[6-oxo-5-(2-oxopropylamino)hexyl]propanamide is sourced from PubChem (CID 21299690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).