C27H28O2 — CID 21299763
4-phenyl-2,3-dihydro-1H-inden-2-ol;4-prop-2-enyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 21299763) has the molecular formula C27H28O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 4-phenyl-2,3-dihydro-1H-inden-2-ol;4-prop-2-enyl-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 4-phenyl-2,3-dihydro-1H-inden-2-ol;4-prop-2-enyl-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 21299763 |
| Molecular Formula | C27H28O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 4-phenyl-2,3-dihydro-1H-inden-2-ol;4-prop-2-enyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | C=CCc1cccc2c1CCC2O.OC1Cc2cccc(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C15H14O.C12H14O/c16-13-9-12-7-4-8-14(15(12)10-13)11-5-2-1-3-6-11;1-2-4-9-5-3-6-11-10(9)7-8-12(11)13/h1-8,13,16H,9-10H2;2-3,5-6,12-13H,1,4,7-8H2 |
| InChIKey | LZBVHXIQVXEQAQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|