C20H29N5O9 — CID 21299896
2-[[2-[[2-[[3-[4-(hydroperoxyamino)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]acetyl]amino]acetic acid (PubChem CID 21299896) has the molecular formula C20H29N5O9 and a molecular weight of 483.48 g/mol. Its IUPAC name is 2-[[2-[[2-[[3-[4-(hydroperoxyamino)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[[3-[4-(hydroperoxyamino)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 21299896 |
| Molecular Formula | C20H29N5O9 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 2-[[2-[[2-[[3-[4-(hydroperoxyamino)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]acetyl]amino]acetic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(NOO)cc1)C(=O)NCC(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C20H29N5O9/c1-20(2,3)33-19(31)24-14(8-12-4-6-13(7-5-12)25-34-32)18(30)23-10-16(27)21-9-15(26)22-11-17(28)29/h4-7,14,25,32H,8-11H2,1-3H3,(H,21,27)(H,22,26)(H,23,30)(H,24,31)(H,28,29) |
| InChIKey | RQAUTFKZNIAEKW-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 204.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|