C13H14F9NO4 — CID 21299958
2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxycarbonylamino)ethyl 2-methylprop-2-enoate (PubChem CID 21299958) has the molecular formula C13H14F9NO4 and a molecular weight of 419.24 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxycarbonylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxycarbonylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 21299958 |
| Molecular Formula | C13H14F9NO4 |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxycarbonylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H14F9NO4/c1-7(2)8(24)26-6-4-23-9(25)27-5-3-10(14,15)11(16,17)12(18,19)13(20,21)22/h1,3-6H2,2H3,(H,23,25) |
| InChIKey | KFXGZKIFILFCCH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|