C15H23OP — CID 21300070
2,2,4,4-tetramethyl-1-(2-phenoxyethyl)phosphetane (PubChem CID 21300070) has the molecular formula C15H23OP and a molecular weight of 250.32 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-1-(2-phenoxyethyl)phosphetane.
| Compound Name | 2,2,4,4-tetramethyl-1-(2-phenoxyethyl)phosphetane |
|---|---|
| PubChem CID | 21300070 |
| Molecular Formula | C15H23OP |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2,2,4,4-tetramethyl-1-(2-phenoxyethyl)phosphetane |
| SMILES | CC1(C)CC(C)(C)P1CCOc1ccccc1 |
| InChI | InChI=1S/C15H23OP/c1-14(2)12-15(3,4)17(14)11-10-16-13-8-6-5-7-9-13/h5-9H,10-12H2,1-4H3 |
| InChIKey | NYKAGZUYWGDRKY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|