About 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one
2,4,4-trimethyl-1H-2,7-naphthyridin-3-one (PubChem CID 21300141) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one.
Molecular Properties
| Compound Name | 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one |
| PubChem CID | 21300141 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one |
| SMILES | CN1Cc2cnccc2C(C)(C)C1=O |
| InChI | InChI=1S/C11H14N2O/c1-11(2)9-4-5-12-6-8(9)7-13(3)10(11)14/h4-6H,7H2,1-3H3 |
| InChIKey | IBVACLPYSZCGFT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one?
The IUPAC name of 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one (CID 21300141) is 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one.
What is the SMILES notation for 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one?
The canonical SMILES for 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one is CN1Cc2cnccc2C(C)(C)C1=O.
What is the InChIKey of 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one?
The InChIKey is IBVACLPYSZCGFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-11(2)9-4-5-12-6-8(9)7-13(3)10(11)14/h4-6H,7H2,1-3H3.
What are the key properties of 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one?
2,4,4-trimethyl-1H-2,7-naphthyridin-3-one has a molecular weight of 190.25 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,4-trimethyl-1H-2,7-naphthyridin-3-one is sourced from PubChem (CID 21300141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).