About 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine
5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine (PubChem CID 21300207) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine |
| PubChem CID | 21300207 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine |
| SMILES | CN1CC(C)(C)c2ncncc21 |
| InChI | InChI=1S/C9H13N3/c1-9(2)5-12(3)7-4-10-6-11-8(7)9/h4,6H,5H2,1-3H3 |
| InChIKey | QCJKNGAQTWUMJI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine?
The IUPAC name of 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine (CID 21300207) is 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine.
What is the SMILES notation for 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine?
The canonical SMILES for 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine is CN1CC(C)(C)c2ncncc21.
What is the InChIKey of 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine?
The InChIKey is QCJKNGAQTWUMJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-9(2)5-12(3)7-4-10-6-11-8(7)9/h4,6H,5H2,1-3H3.
What are the key properties of 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine?
5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine has a molecular weight of 163.22 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine is sourced from PubChem (CID 21300207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).