C9H13N3 — CID 21300207
5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine (PubChem CID 21300207) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine.
| Compound Name | 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 21300207 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5,7,7-trimethyl-6H-pyrrolo[3,2-d]pyrimidine |
| SMILES | CN1CC(C)(C)c2ncncc21 |
| InChI | InChI=1S/C9H13N3/c1-9(2)5-12(3)7-4-10-6-11-8(7)9/h4,6H,5H2,1-3H3 |
| InChIKey | QCJKNGAQTWUMJI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |