About 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one
6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 21300280) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one |
| PubChem CID | 21300280 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | CN1C(=O)c2cncnc2C1(C)C |
| InChI | InChI=1S/C9H11N3O/c1-9(2)7-6(4-10-5-11-7)8(13)12(9)3/h4-5H,1-3H3 |
| InChIKey | SBYGWGVBBVHJCR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one?
The IUPAC name of 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one (CID 21300280) is 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one.
What is the SMILES notation for 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one?
The canonical SMILES for 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one is CN1C(=O)c2cncnc2C1(C)C.
What is the InChIKey of 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one?
The InChIKey is SBYGWGVBBVHJCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-9(2)7-6(4-10-5-11-7)8(13)12(9)3/h4-5H,1-3H3.
What are the key properties of 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one?
6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one has a molecular weight of 177.21 g/mol, XLogP of 0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7,7-trimethylpyrrolo[3,4-d]pyrimidin-5-one is sourced from PubChem (CID 21300280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).