About tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate
tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate (PubChem CID 21300388) has the molecular formula C8H11BrN2O2S
and a molecular weight of 279.16 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate |
| PubChem CID | 21300388 |
| Molecular Formula | C8H11BrN2O2S |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C8H11BrN2O2S/c1-8(2,3)13-7(12)11-6-10-4-5(9)14-6/h4H,1-3H3,(H,10,11,12) |
| InChIKey | OIBKBVFFZYCBAQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate?
The IUPAC name of tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate (CID 21300388) is tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate?
The canonical SMILES for tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate is CC(C)(C)OC(=O)Nc1ncc(Br)s1.
What is the InChIKey of tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate?
The InChIKey is OIBKBVFFZYCBAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN2O2S/c1-8(2,3)13-7(12)11-6-10-4-5(9)14-6/h4H,1-3H3,(H,10,11,12).
What are the key properties of tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate?
tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate has a molecular weight of 279.16 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 21300388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).