C16H18NO6- — CID 21300891
2-[1-[2-(1,3-benzodioxol-5-yl)acetyl]-4-hydroxypiperidin-4-yl]acetate (PubChem CID 21300891) has the molecular formula C16H18NO6- and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-[1-[2-(1,3-benzodioxol-5-yl)acetyl]-4-hydroxypiperidin-4-yl]acetate.
| Compound Name | 2-[1-[2-(1,3-benzodioxol-5-yl)acetyl]-4-hydroxypiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 21300891 |
| Molecular Formula | C16H18NO6- |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-[1-[2-(1,3-benzodioxol-5-yl)acetyl]-4-hydroxypiperidin-4-yl]acetate |
| SMILES | O=C([O-])CC1(O)CCN(C(=O)Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C16H19NO6/c18-14(8-11-1-2-12-13(7-11)23-10-22-12)17-5-3-16(21,4-6-17)9-15(19)20/h1-2,7,21H,3-6,8-10H2,(H,19,20)/p-1 |
| InChIKey | PKOPFJCAPQFHBJ-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |