C16H23F3 — CID 21301227
4,9,10-trimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 21301227) has the molecular formula C16H23F3 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4,9,10-trimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 4,9,10-trimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 21301227 |
| Molecular Formula | C16H23F3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 4,9,10-trimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CC1C(C)C2CC1C1C3CC(C21)C(C)(C(F)(F)F)C3 |
| InChI | InChI=1S/C16H23F3/c1-7-8(2)11-5-10(7)13-9-4-12(14(11)13)15(3,6-9)16(17,18)19/h7-14H,4-6H2,1-3H3 |
| InChIKey | GVROQFXLQNVCQG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|