C8H16N2O2 — CID 21301390
2-(methylamino)-3-[methyl(prop-2-enyl)amino]propanoic acid (PubChem CID 21301390) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-(methylamino)-3-[methyl(prop-2-enyl)amino]propanoic acid.
| Compound Name | 2-(methylamino)-3-[methyl(prop-2-enyl)amino]propanoic acid |
|---|---|
| PubChem CID | 21301390 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 2-(methylamino)-3-[methyl(prop-2-enyl)amino]propanoic acid |
| SMILES | C=CCN(C)CC(NC)C(=O)O |
| InChI | InChI=1S/C8H16N2O2/c1-4-5-10(3)6-7(9-2)8(11)12/h4,7,9H,1,5-6H2,2-3H3,(H,11,12) |
| InChIKey | BXDMSBLZPNLZPY-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|