About (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate
(9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 21301442) has the molecular formula C19H24O4
and a molecular weight of 316.40 g/mol. Its IUPAC name is (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
Molecular Properties
| Compound Name | (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| PubChem CID | 21301442 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCC1C(=O)OC2CC1C1CCCC21)C1CC2C=CC1C2 |
| InChI | InChI=1S/C19H24O4/c20-18(14-7-10-4-5-11(14)6-10)22-9-16-15-8-17(23-19(16)21)13-3-1-2-12(13)15/h4-5,10-17H,1-3,6-9H2 |
| InChIKey | GDGJXPMSEQIANM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 21301442) is (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate is O=C(OCC1C(=O)OC2CC1C1CCCC21)C1CC2C=CC1C2.
What is the InChIKey of (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is GDGJXPMSEQIANM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O4/c20-18(14-7-10-4-5-11(14)6-10)22-9-16-15-8-17(23-19(16)21)13-3-1-2-12(13)15/h4-5,10-17H,1-3,6-9H2.
What are the key properties of (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
(9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 316.40 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9-oxo-8-oxatricyclo[5.3.1.02,6]undecan-10-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 21301442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).