C35H30N2O4S — CID 21301967
2-[3-(2,6-dimethylanilino)-6-(2,6-dimethylphenyl)azaniumylidenexanthen-9-yl]benzenesulfonate (PubChem CID 21301967) has the molecular formula C35H30N2O4S and a molecular weight of 574.70 g/mol. Its IUPAC name is 2-[3-(2,6-dimethylanilino)-6-(2,6-dimethylphenyl)azaniumylidenexanthen-9-yl]benzenesulfonate.
| Compound Name | 2-[3-(2,6-dimethylanilino)-6-(2,6-dimethylphenyl)azaniumylidenexanthen-9-yl]benzenesulfonate |
|---|---|
| PubChem CID | 21301967 |
| Molecular Formula | C35H30N2O4S |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 2-[3-(2,6-dimethylanilino)-6-(2,6-dimethylphenyl)azaniumylidenexanthen-9-yl]benzenesulfonate |
| SMILES | Cc1cccc(C)c1Nc1ccc2c(-c3ccccc3S(=O)(=O)[O-])c3cc/c(=[NH+]\c4c(C)cccc4C)cc-3oc2c1 |
| InChI | InChI=1S/C35H30N2O4S/c1-21-9-7-10-22(2)34(21)36-25-15-17-27-30(19-25)41-31-20-26(37-35-23(3)11-8-12-24(35)4)16-18-28(31)33(27)29-13-5-6-14-32(29)42(38,39)40/h5-20,36H,1-4H3,(H,38,39,40)/b37-26+ |
| InChIKey | XECPZCIPBHMXQF-AVLPFNLUSA-N |
| XLogP | 6.40 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|