C18H24F6O3 — CID 21301996
[2-[(4,5-dimethyl-3-oxatricyclo[6.2.1.02,7]undecan-10-yl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] acetate (PubChem CID 21301996) has the molecular formula C18H24F6O3 and a molecular weight of 402.38 g/mol. Its IUPAC name is [2-[(4,5-dimethyl-3-oxatricyclo[6.2.1.02,7]undecan-10-yl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] acetate.
| Compound Name | [2-[(4,5-dimethyl-3-oxatricyclo[6.2.1.02,7]undecan-10-yl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] acetate |
|---|---|
| PubChem CID | 21301996 |
| Molecular Formula | C18H24F6O3 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [2-[(4,5-dimethyl-3-oxatricyclo[6.2.1.02,7]undecan-10-yl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] acetate |
| SMILES | CC(=O)OC(CC1CC2CC1C1OC(C)C(C)CC21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H24F6O3/c1-8-4-13-11-5-12(14(6-11)15(13)26-9(8)2)7-16(17(19,20)21,18(22,23)24)27-10(3)25/h8-9,11-15H,4-7H2,1-3H3 |
| InChIKey | TVCZCGXPUWWCLV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |