C16H15N3S — CID 21302008
4-(2,2-diphenylethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 21302008) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 4-(2,2-diphenylethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2,2-diphenylethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 21302008 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-(2,2-diphenylethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15N3S/c20-16-18-17-12-19(16)11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,12,15H,11H2,(H,18,20) |
| InChIKey | YEUTZRNIFDFXDG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|