C28H28O6 — CID 21302031
[2,2-bis(benzoyloxymethyl)-3-methylbutyl] benzoate (PubChem CID 21302031) has the molecular formula C28H28O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is [2,2-bis(benzoyloxymethyl)-3-methylbutyl] benzoate.
| Compound Name | [2,2-bis(benzoyloxymethyl)-3-methylbutyl] benzoate |
|---|---|
| PubChem CID | 21302031 |
| Molecular Formula | C28H28O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | [2,2-bis(benzoyloxymethyl)-3-methylbutyl] benzoate |
| SMILES | CC(C)C(COC(=O)c1ccccc1)(COC(=O)c1ccccc1)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H28O6/c1-21(2)28(18-32-25(29)22-12-6-3-7-13-22,19-33-26(30)23-14-8-4-9-15-23)20-34-27(31)24-16-10-5-11-17-24/h3-17,21H,18-20H2,1-2H3 |
| InChIKey | VFKCLOBZSPZQPI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|