About N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide
N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide (PubChem CID 21302154) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide |
| PubChem CID | 21302154 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide |
| SMILES | CN(C)CCNC(=O)C1=CC=CC1 |
| InChI | InChI=1S/C10H16N2O/c1-12(2)8-7-11-10(13)9-5-3-4-6-9/h3-5H,6-8H2,1-2H3,(H,11,13) |
| InChIKey | UHUDRQPXTJUYPZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide?
The IUPAC name of N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide (CID 21302154) is N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide.
What is the SMILES notation for N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide?
The canonical SMILES for N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide is CN(C)CCNC(=O)C1=CC=CC1.
What is the InChIKey of N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide?
The InChIKey is UHUDRQPXTJUYPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-12(2)8-7-11-10(13)9-5-3-4-6-9/h3-5H,6-8H2,1-2H3,(H,11,13).
What are the key properties of N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide?
N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide has a molecular weight of 180.25 g/mol, XLogP of 0.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)ethyl]cyclopenta-1,3-diene-1-carboxamide is sourced from PubChem (CID 21302154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).