C20H17F5N2S — CID 21302480
(11S,16R)-3-(2,3,4,5,6-pentafluorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene (PubChem CID 21302480) has the molecular formula C20H17F5N2S and a molecular weight of 412.43 g/mol. Its IUPAC name is (11S,16R)-3-(2,3,4,5,6-pentafluorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene.
| Compound Name | (11S,16R)-3-(2,3,4,5,6-pentafluorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 21302480 |
| Molecular Formula | C20H17F5N2S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | (11S,16R)-3-(2,3,4,5,6-pentafluorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
| SMILES | Fc1c(F)c(F)c(-c2cc3c4c(c2)[C@@H]2CNCC[C@@H]2N4CCCS3)c(F)c1F |
| InChI | InChI=1S/C20H17F5N2S/c21-15-14(16(22)18(24)19(25)17(15)23)9-6-10-11-8-26-3-2-12(11)27-4-1-5-28-13(7-9)20(10)27/h6-7,11-12,26H,1-5,8H2/t11-,12-/m0/s1 |
| InChIKey | YXWNHBQDKWKGSY-RYUDHWBXSA-N |
| XLogP | 4.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|