About 1-propyl-3-(1,3-thiazol-2-yl)urea
1-propyl-3-(1,3-thiazol-2-yl)urea (PubChem CID 2130249) has the molecular formula C7H11N3OS
and a molecular weight of 185.25 g/mol. Its IUPAC name is 1-propyl-3-(1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-propyl-3-(1,3-thiazol-2-yl)urea |
| PubChem CID | 2130249 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 1-propyl-3-(1,3-thiazol-2-yl)urea |
| SMILES | CCCNC(=O)Nc1nccs1 |
| InChI | InChI=1S/C7H11N3OS/c1-2-3-8-6(11)10-7-9-4-5-12-7/h4-5H,2-3H2,1H3,(H2,8,9,10,11) |
| InChIKey | AYBSLNUHBOEHRE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propyl-3-(1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-3-(1,3-thiazol-2-yl)urea?
The IUPAC name of 1-propyl-3-(1,3-thiazol-2-yl)urea (CID 2130249) is 1-propyl-3-(1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-propyl-3-(1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-propyl-3-(1,3-thiazol-2-yl)urea is CCCNC(=O)Nc1nccs1.
What is the InChIKey of 1-propyl-3-(1,3-thiazol-2-yl)urea?
The InChIKey is AYBSLNUHBOEHRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3OS/c1-2-3-8-6(11)10-7-9-4-5-12-7/h4-5H,2-3H2,1H3,(H2,8,9,10,11).
What are the key properties of 1-propyl-3-(1,3-thiazol-2-yl)urea?
1-propyl-3-(1,3-thiazol-2-yl)urea has a molecular weight of 185.25 g/mol, XLogP of 1.67, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-3-(1,3-thiazol-2-yl)urea is sourced from PubChem (CID 2130249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).