C16H23N3 — CID 21302498
(10R,15S)-4-propan-2-yl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (PubChem CID 21302498) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is (10R,15S)-4-propan-2-yl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene.
| Compound Name | (10R,15S)-4-propan-2-yl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
|---|---|
| PubChem CID | 21302498 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | (10R,15S)-4-propan-2-yl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| SMILES | CC(C)N1CCN2c3c(cccc31)[C@@H]1CNCC[C@@H]12 |
| InChI | InChI=1S/C16H23N3/c1-11(2)18-8-9-19-14-6-7-17-10-13(14)12-4-3-5-15(18)16(12)19/h3-5,11,13-14,17H,6-10H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | NNDWCWODSHSNPT-KBPBESRZSA-N |
| XLogP | 2.18 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |