C22H25FN2S — CID 21302519
(11R,16S)-14-[2-(4-fluorophenyl)ethyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene (PubChem CID 21302519) has the molecular formula C22H25FN2S and a molecular weight of 368.52 g/mol. Its IUPAC name is (11R,16S)-14-[2-(4-fluorophenyl)ethyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene.
| Compound Name | (11R,16S)-14-[2-(4-fluorophenyl)ethyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 21302519 |
| Molecular Formula | C22H25FN2S |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (11R,16S)-14-[2-(4-fluorophenyl)ethyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
| SMILES | Fc1ccc(CCN2CC[C@@H]3[C@H](C2)c2cccc4c2N3CCCS4)cc1 |
| InChI | InChI=1S/C22H25FN2S/c23-17-7-5-16(6-8-17)9-12-24-13-10-20-19(15-24)18-3-1-4-21-22(18)25(20)11-2-14-26-21/h1,3-8,19-20H,2,9-15H2/t19-,20-/m1/s1 |
| InChIKey | PDBFYQCVMCXGNU-WOJBJXKFSA-N |
| XLogP | 4.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |