C20H30N2S — CID 21302528
(11R,16S)-14-(2-methylpentyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene (PubChem CID 21302528) has the molecular formula C20H30N2S and a molecular weight of 330.54 g/mol. Its IUPAC name is (11R,16S)-14-(2-methylpentyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene.
| Compound Name | (11R,16S)-14-(2-methylpentyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 21302528 |
| Molecular Formula | C20H30N2S |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (11R,16S)-14-(2-methylpentyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
| SMILES | CCCC(C)CN1CC[C@@H]2[C@H](C1)c1cccc3c1N2CCCS3 |
| InChI | InChI=1S/C20H30N2S/c1-3-6-15(2)13-21-11-9-18-17(14-21)16-7-4-8-19-20(16)22(18)10-5-12-23-19/h4,7-8,15,17-18H,3,5-6,9-14H2,1-2H3/t15?,17-,18-/m1/s1 |
| InChIKey | JBNJMYJWKGRJQG-HSFDIDPMSA-N |
| XLogP | 4.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |