C30H32F2N2S — CID 21302548
(11R,16S)-14-[4,4-bis(4-fluorophenyl)butyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene (PubChem CID 21302548) has the molecular formula C30H32F2N2S and a molecular weight of 490.66 g/mol. Its IUPAC name is (11R,16S)-14-[4,4-bis(4-fluorophenyl)butyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene.
| Compound Name | (11R,16S)-14-[4,4-bis(4-fluorophenyl)butyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 21302548 |
| Molecular Formula | C30H32F2N2S |
| Molecular Weight | 490.66 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | (11R,16S)-14-[4,4-bis(4-fluorophenyl)butyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
| SMILES | Fc1ccc(C(CCCN2CC[C@@H]3[C@H](C2)c2cccc4c2N3CCCS4)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C30H32F2N2S/c31-23-11-7-21(8-12-23)25(22-9-13-24(32)14-10-22)5-2-16-33-18-15-28-27(20-33)26-4-1-6-29-30(26)34(28)17-3-19-35-29/h1,4,6-14,25,27-28H,2-3,5,15-20H2/t27-,28-/m1/s1 |
| InChIKey | NKQNGXIHKXZVPA-VSGBNLITSA-N |
| XLogP | 7.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.66 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |