C24H36N2S — CID 21302551
(11R,16S)-14-(4-cyclohexylbutyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene (PubChem CID 21302551) has the molecular formula C24H36N2S and a molecular weight of 384.63 g/mol. Its IUPAC name is (11R,16S)-14-(4-cyclohexylbutyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene.
| Compound Name | (11R,16S)-14-(4-cyclohexylbutyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 21302551 |
| Molecular Formula | C24H36N2S |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | (11R,16S)-14-(4-cyclohexylbutyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
| SMILES | c1cc2c3c(c1)[C@H]1CN(CCCCC4CCCCC4)CC[C@H]1N3CCCS2 |
| InChI | InChI=1S/C24H36N2S/c1-2-8-19(9-3-1)10-4-5-14-25-16-13-22-21(18-25)20-11-6-12-23-24(20)26(22)15-7-17-27-23/h6,11-12,19,21-22H,1-5,7-10,13-18H2/t21-,22-/m1/s1 |
| InChIKey | VEICCRIVVYZTGH-FGZHOGPDSA-N |
| XLogP | 5.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|