C21H21F3N2S — CID 21302587
(11R,16S)-3-[3-(trifluoromethyl)phenyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene (PubChem CID 21302587) has the molecular formula C21H21F3N2S and a molecular weight of 390.47 g/mol. Its IUPAC name is (11R,16S)-3-[3-(trifluoromethyl)phenyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene.
| Compound Name | (11R,16S)-3-[3-(trifluoromethyl)phenyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 21302587 |
| Molecular Formula | C21H21F3N2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (11R,16S)-3-[3-(trifluoromethyl)phenyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
| SMILES | FC(F)(F)c1cccc(-c2cc3c4c(c2)[C@H]2CNCC[C@H]2N4CCCS3)c1 |
| InChI | InChI=1S/C21H21F3N2S/c22-21(23,24)15-4-1-3-13(9-15)14-10-16-17-12-25-6-5-18(17)26-7-2-8-27-19(11-14)20(16)26/h1,3-4,9-11,17-18,25H,2,5-8,12H2/t17-,18-/m1/s1 |
| InChIKey | GCUDUNADUNVWJL-QZTJIDSGSA-N |
| XLogP | 5.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |