C20H21FN2S — CID 21302592
(11R,16S)-3-(4-fluorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene (PubChem CID 21302592) has the molecular formula C20H21FN2S and a molecular weight of 340.47 g/mol. Its IUPAC name is (11R,16S)-3-(4-fluorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene.
| Compound Name | (11R,16S)-3-(4-fluorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 21302592 |
| Molecular Formula | C20H21FN2S |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (11R,16S)-3-(4-fluorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
| SMILES | Fc1ccc(-c2cc3c4c(c2)[C@H]2CNCC[C@H]2N4CCCS3)cc1 |
| InChI | InChI=1S/C20H21FN2S/c21-15-4-2-13(3-5-15)14-10-16-17-12-22-7-6-18(17)23-8-1-9-24-19(11-14)20(16)23/h2-5,10-11,17-18,22H,1,6-9,12H2/t17-,18-/m1/s1 |
| InChIKey | GSWUGHHWCAERJA-QZTJIDSGSA-N |
| XLogP | 4.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |