About 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole
1-(2-methoxyethyl)-5,6-dimethylbenzimidazole (PubChem CID 2130269) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole |
| PubChem CID | 2130269 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole |
| SMILES | COCCn1cnc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C12H16N2O/c1-9-6-11-12(7-10(9)2)14(8-13-11)4-5-15-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | MTCVKMZYOBRKHW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole?
The IUPAC name of 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole (CID 2130269) is 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole.
What is the SMILES notation for 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole?
The canonical SMILES for 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole is COCCn1cnc2cc(C)c(C)cc21.
What is the InChIKey of 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole?
The InChIKey is MTCVKMZYOBRKHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-9-6-11-12(7-10(9)2)14(8-13-11)4-5-15-3/h6-8H,4-5H2,1-3H3.
What are the key properties of 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole?
1-(2-methoxyethyl)-5,6-dimethylbenzimidazole has a molecular weight of 204.27 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-5,6-dimethylbenzimidazole is sourced from PubChem (CID 2130269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).