About 4-aminocyclopentane-1,2,3-triol
4-aminocyclopentane-1,2,3-triol (PubChem CID 21303210) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 4-aminocyclopentane-1,2,3-triol.
Molecular Properties
| Compound Name | 4-aminocyclopentane-1,2,3-triol |
| PubChem CID | 21303210 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 4-aminocyclopentane-1,2,3-triol |
| SMILES | NC1CC(O)C(O)C1O |
| InChI | InChI=1S/C5H11NO3/c6-2-1-3(7)5(9)4(2)8/h2-5,7-9H,1,6H2 |
| InChIKey | UUKWSEIZIMUXPU-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-aminocyclopentane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminocyclopentane-1,2,3-triol?
The IUPAC name of 4-aminocyclopentane-1,2,3-triol (CID 21303210) is 4-aminocyclopentane-1,2,3-triol.
What is the SMILES notation for 4-aminocyclopentane-1,2,3-triol?
The canonical SMILES for 4-aminocyclopentane-1,2,3-triol is NC1CC(O)C(O)C1O.
What is the InChIKey of 4-aminocyclopentane-1,2,3-triol?
The InChIKey is UUKWSEIZIMUXPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c6-2-1-3(7)5(9)4(2)8/h2-5,7-9H,1,6H2.
What are the key properties of 4-aminocyclopentane-1,2,3-triol?
4-aminocyclopentane-1,2,3-triol has a molecular weight of 133.15 g/mol, XLogP of -2.20, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminocyclopentane-1,2,3-triol is sourced from PubChem (CID 21303210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).