About N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide
N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide (PubChem CID 21303222) has the molecular formula C7H9F3N2OS
and a molecular weight of 226.22 g/mol. Its IUPAC name is N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide |
| PubChem CID | 21303222 |
| Molecular Formula | C7H9F3N2OS |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide |
| SMILES | CSCCN(CC#N)C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2OS/c1-14-5-4-12(3-2-11)6(13)7(8,9)10/h3-5H2,1H3 |
| InChIKey | DRJVOUZXMIWBOL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide?
The IUPAC name of N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide (CID 21303222) is N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide.
What is the SMILES notation for N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide?
The canonical SMILES for N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide is CSCCN(CC#N)C(=O)C(F)(F)F.
What is the InChIKey of N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide?
The InChIKey is DRJVOUZXMIWBOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2OS/c1-14-5-4-12(3-2-11)6(13)7(8,9)10/h3-5H2,1H3.
What are the key properties of N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide?
N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide has a molecular weight of 226.22 g/mol, XLogP of 1.26, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-2,2,2-trifluoro-N-(2-methylsulfanylethyl)acetamide is sourced from PubChem (CID 21303222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).