C33H50N2O2S6 — CID 21303506
5-[6-[3-[6-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-5,5-dimethylhexoxy]propoxy]-2,2-dimethylhexyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 21303506) has the molecular formula C33H50N2O2S6 and a molecular weight of 699.18 g/mol. Its IUPAC name is 5-[6-[3-[6-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-5,5-dimethylhexoxy]propoxy]-2,2-dimethylhexyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
| Compound Name | 5-[6-[3-[6-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-5,5-dimethylhexoxy]propoxy]-2,2-dimethylhexyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
|---|---|
| PubChem CID | 21303506 |
| Molecular Formula | C33H50N2O2S6 |
| Molecular Weight | 699.18 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | 5-[6-[3-[6-[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl]-5,5-dimethylhexoxy]propoxy]-2,2-dimethylhexyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | CC(C)(CCCCOCCCOCCCCC(C)(C)CN1C(=S)C=C2SCCC2C1=S)CN1C(=S)C=C2SCCC2C1=S |
| InChI | InChI=1S/C33H50N2O2S6/c1-32(2,22-34-28(38)20-26-24(30(34)40)10-18-42-26)12-5-7-14-36-16-9-17-37-15-8-6-13-33(3,4)23-35-29(39)21-27-25(31(35)41)11-19-43-27/h20-21,24-25H,5-19,22-23H2,1-4H3 |
| InChIKey | UGWJHGRSWQUZFB-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.18 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|