C15H34O8S2 — CID 21303563
4-[3-[3,3-dimethyl-4-(trihydroxy-λ4-sulfanyl)butoxy]propoxy]-2,2-dimethylbutane-1-sulfonic acid (PubChem CID 21303563) has the molecular formula C15H34O8S2 and a molecular weight of 406.56 g/mol. Its IUPAC name is 4-[3-[3,3-dimethyl-4-(trihydroxy-λ4-sulfanyl)butoxy]propoxy]-2,2-dimethylbutane-1-sulfonic acid.
| Compound Name | 4-[3-[3,3-dimethyl-4-(trihydroxy-λ4-sulfanyl)butoxy]propoxy]-2,2-dimethylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 21303563 |
| Molecular Formula | C15H34O8S2 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 4-[3-[3,3-dimethyl-4-(trihydroxy-λ4-sulfanyl)butoxy]propoxy]-2,2-dimethylbutane-1-sulfonic acid |
| SMILES | CC(C)(CCOCCCOCCC(C)(C)CS(=O)(=O)O)CS(O)(O)O |
| InChI | InChI=1S/C15H34O8S2/c1-14(2,12-24(16,17)18)6-10-22-8-5-9-23-11-7-15(3,4)13-25(19,20)21/h16-18H,5-13H2,1-4H3,(H,19,20,21) |
| InChIKey | BOZBRMIITZGSBP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|